S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: EPH F.M.: 40

Time : 2hrs P.M: 15

1. Very short question answers.

a. Define health by WHO.

b. Write any two characteristics of a healthy person.

c. Write any one scope of health education.

d. Define environment.

e. Give an example which proves that science and technological factors affect environment.

f. Mention any one way of influencing human health by political aspect.

g. What is a family?

h. Name the forms of family?

i. Write any one role of parents in family.

j. What is marriage?

2. Short questions answers.

k. Write any 4 need and importance of health education?

l. Write short note on “Importance of population education”.

m. Write any 4 aspects that can be established interrelationship between health education, population and environment education.

n. Write any 4 importance of family life education.

o. Write any 2 differences between nuclear and joint family?

3. Long question answers.

p. A healthy environment ensure healthy life. Do you agree? Justify.

q. What roles can we play to provide health education to be community?

r. What are the characteristics of Nepali family?

s. What are the functions of family? Describe any 3 of them.

t. How can we care the elderly people in family? Give your suggestions.

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: EPH F.M.: 40

Time : 2hrs P.M: 15

1. Very short question answers.

a. Define health by WHO.

b. Write any two characteristics of a healthy person.

c. Write any one scope of health education.

d. Define environment.

e. Give an example which proves that science and technological factors affect environment.

f. Mention any one way of influencing human health by political aspect.

g. What is a family?

h. Name the forms of family?

i. Write any one role of parents in family.

j. What is marriage?

2. Short questions answers.

k. Write any 4 need and importance of health education?

l. Write short note on “Importance of population education”.

m. Write any 4 aspects that can be established interrelationship between health education, population and environment education.

n. Write any 4 importance of family life education.

o. Write any 2 differences between nuclear and joint family?

3. Long question answers.

p. A healthy environment ensure healthy life. Do you agree? Justify.

q. What roles can we play to provide health education to be community?

r. What are the characteristics of Nepali family?

s. What are the functions of family? Describe any 3 of them.

t. How can we care the elderly people in family? Give your suggestions.

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: Science F.M.: 40

Time : 2hrs P.M: 15

Candidates are required to give their answers in their own words as far as practicable. The figures in the margin indicate full marks.

Group 'A' [2x12]

1. What are SI units? How is standard 1 kg weight developed in a country?

2. Why is unit of force called derived unit?

3. Define 1m length.

4. State Newton's second law of motion and prove F=ma.

5. Deduce the relation v2-u2=2as, where u is the initial velocity, v the final velocity, a

the acceleration and s the distance covered by the body.

6. If a man jumps out from a boat, the boat moves backwards. Explain with reason.

7. Differentiate: Electrovalent bond and Covalent bond

8. What is a radical? Give two examples.

9. Explain how sodium chloride is formed.

10. What do you mean by binomial system of nomenclature?

11. Mention three importance of classification in the study of biology.

12. Differentiate: Bryophyta and Pteridophyta

Group 'B'

13. Write down characteristics feature of coelenterate. [2]

14. Identify the phyla of animal or division of plant with the given salient features: 2

a) Diploblastic, multi-cellular, fixed, aquatic, body with numerous pores

b) Locomotion by pseudopodia

15. Classify devil fish. [1]

16. Write the molecular formulae of the following compounds: [1.5]

a) Calcium sulphate b) Calcium bicarbonate c) Ammonium sulphate

17. Correct the molecular formulae given below: [3]

Mg2SO4, HO2, CaO2, Ca2(OH)3, KOH2, CaCl

18. What are valency of following radicals: [1.5]

OH, HCO3, NH4

19. A car moving with 20 m/s stopped at a distance of 20 m. Find the time required

to stop it. [2]

20. A truck of mass 5000 kg moving with a uniform velocity of 72 km/hr, is stopped

in 4 secs on applying brakes. Calculate the force applied on the brake to stop the

truck. [2]

21. Find the volume of the cylinder whose height is 10cm and radius is 2cm. [1]

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: Science F.M.: 40

Time : 2hrs P.M: 15

Candidates are required to give their answers in their own words as far as practicable. The figures in the margin indicate full marks.

Group 'A' [2x12]

1. What are SI units? How is standard 1 kg weight developed in a country?

2. Why is unit of force called derived unit?

3. Define 1m length.

4. State Newton's second law of motion and prove F=ma.

5. Deduce the relation v2-u2=2as, where u is the initial velocity, v the final velocity, a

the acceleration and s the distance covered by the body.

6. If a man jumps out from a boat, the boat moves backwards. Explain with reason.

7. Differentiate: Electrovalent bond and Covalent bond

8. What is a radical? Give two examples.

9. Explain how sodium chloride is formed.

10. What do you mean by binomial system of nomenclature?

11. Mention three importance of classification in the study of biology.

12. Differentiate: Bryophyta and Pteridophyta

Group 'B'

13. Write down characteristics feature of coelenterate. [2]

14. Identify the phyla of animal or division of plant with the given salient features: 2

a) Diploblastic, multi-cellular, fixed, aquatic, body with numerous pores

b) Locomotion by pseudopodia

15. Classify devil fish. [1]

16. Write the molecular formulae of the following compounds: [1.5]

a) Calcium sulphate b) Calcium bicarbonate c) Ammonium sulphate

17. Correct the molecular formulae given below: [3]

Mg2SO4, HO2, CaO2, Ca2(OH)3, KOH2, CaCl

18. What are valency of following radicals: [1.5]

OH, HCO3, NH4

19. A car moving with 20 m/s stopped at a distance of 20 m. Find the time required

to stop it. [2]

20. A truck of mass 5000 kg moving with a uniform velocity of 72 km/hr, is stopped

in 4 secs on applying brakes. Calculate the force applied on the brake to stop the

truck. [2]

21. Find the volume of the cylinder whose height is 10cm and radius is 2cm. [1]

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: H.P.E. F.M.: 40

Time : 2hrs P.M: 15

Attempt all the questions.

A. Answer the following questions in very short: - 10

1. How does WHO define Health?

2. Write any two qualities of a healthy person.

3. Define tissue. Mention its types.

4. What percent of water is found in bones?

5. Give any two examples of connective tissues.

6. How many types of bones are found in human body?

7. Name the bones of cranium.

8. How many total carpal bones are found in the human body?

9. How many pairs of ribs are there in the human body? Mention any one major function of ribs.

10. Write the name of joints found in the human body.

B. Answer the following questions in brief: - 3 x 10 = 30

11. Explain the meaning of Health in your own words.

12. Discuss briefly the objectives of Health Education.

13. Explain the importance of Health Education, in brief.

14. Explain the microscopic structure of a cell.

15. Describe the major functions of bone.

16. Sketch a labeled diagram of human skull.

17. List the bones of vertebral column with their number.

18. What is joint? Explain the types of joint.

19. List the types of freely movable joint with an example.

20. List the major systems of human body.

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: H.P.E. F.M.: 40

Time : 2hrs P.M: 15

Attempt all the questions.

A. Answer the following questions in very short: - 10

1. How does WHO define Health?

2. Write any two qualities of a healthy person.

3. Define tissue. Mention its types.

4. What percent of water is found in bones?

5. Give any two examples of connective tissues.

6. How many types of bones are found in human body?

7. Name the bones of cranium.

8. How many total carpal bones are found in the human body?

9. How many pairs of ribs are there in the human body? Mention any one major function of ribs.

10. Write the name of joints found in the human body.

B. Answer the following questions in brief: - 3 x 10 = 30

11. Explain the meaning of Health in your own words.

12. Discuss briefly the objectives of Health Education.

13. Explain the importance of Health Education, in brief.

14. Explain the microscopic structure of a cell.

15. Describe the major functions of bone.

16. Sketch a labeled diagram of human skull.

17. List the bones of vertebral column with their number.

18. What is joint? Explain the types of joint.

19. List the types of freely movable joint with an example.

20. List the major systems of human body.

The End

>L=/f=g]=;]=af]=:=

k|yd q}dfl;s k/LIff @)&@

sIff M ( k"= $)

;do M @ 306f ljifo M g]kfnL p= !$

;a} k|Zgx? clgjfo{ 5g\ .

!= tnsf zAbx?sf] cy{;Fu hf]8f ldnfpg'xf];\ . @=%

b|'d e¥ofª, l;9L

cfNxflbt ?v

;f}/e v';L

;f]kfg b'af]

Bf]ts af:gf

;"rs

@= vfnL 7fFpdf ldNg] zAb eg{'xf];\ M @=%

s_ g]kfn k|fs[lts cg'kd ======================= pTs[i6 gd'gf xf] .

v_ ko{6g xfd|f] cy{tGqsf] ============================= xf] / cltly xfd|f cfTdf x'g\ .

u_ /fgL k/nf]s x'Fbf ;f/f ==================== ?jfjf;L rNof] .

3_ j;Gt Ct'df =============================== kfOG5 .

ª_ gfusf] xTof u/]kl5 lzlz/ ======================= /fhf ag] .

#= 7Ls eP -√_ / a]l7s eP -ᵡ_ lrXg nufpg'xf];\ M @=%

s_ j;Gtn] afNofsfndf w]/} b' M v kfP .

v_ cltly ;Tsf/n] xfd|f] klxrfgnfO{ c;/ k'¥ofpb}g .

u_ 3/of;L lr7Ldf ldlt n]Vg' kb}{g .

3_ dfdfsf] kq k9]/ efGhf l/;fP .

ª_ lgaGw b'O{ k|sf/sf] x'G5g\ .

$= tnsf] cg'R5]b k9]/ pQ/ lbg'xf];\ M %

df}/Lsf] cl:tTj dfgj ;Eotfsf] ljsf; x'g'eGbf cl3b]lv /x]sf] cg'dfg ul/G5 . lxGb' ;+:s[ltsf b]jsfo{ tyf lkt[sfo{x?df dx cToGt cfjZos 7flgG5 . k~rfd[tdf of] Ps tTjsf ?kdf k|l;4 5 . dxnfO{ cd[t eg] klg x'G5 . gjhft lzz'nfO{ cfdfsf] :tgkfg u/fpg'eGbf klxn] dx r6fpg] k/Dk/f 5 . cfo'j]{bsf sltko cf}ifwL dx;Fu ;]jg ug]{ vfnsf x'G5g\ . df}/Lsf] dx cToGt pkof]uL x'gfn] cfh ef]ln Joj;fosf] ?kdf df}/L kfNg] rng 5 . df}/L kfng Joj;fonfO{ cfw'lgs ?k lbg] sfo{ ;j{k|yd cd]l/sfsf kfb/L Nofª :6«fyn] ;g\ !*%! Df u/]sf x'g\ . pgn] df}/L kfNg] rf}sf]; ePsf] 3f/sf] ljsf; u/]sf x'g\ .

s_ df}/L kfng Joj;fo cfw'lgs ?k s;n] lbof] <

v_ df}/Lsf] cl:tTj slxn] b]lv eof] <

u_ dx s:tf] tTj xf] <

3_ gjhft lzz'nfO{ cfdfsf] b'w eGbf klxnf s] r6fpg] rng 5 <

ª_ dx s] s:tf sfo{df dxTjk"0f{ 5 <

%=tnsf k|Zgx?sf] pQ/ n]Vg'xf];\ M !)

s_ sljnfO{ j;Gt Ct' dg kg{'sf sf/0f s] x'g\ <

v_ lzlz/ / j;Gtsf] syfn] lbg] ;Gb]z s] xf] <

u_ ko{6gnfO{ s;/L cfocfh{gsf] ;|f]t agfpg ;lsG5 <

3_ lghL klxrfg sfod /fVg xfdLn] s] s] ug{'k5{ <

ª_ lzlz/ / j;Gtsf] ldng s;/L eof] <

^= ltdLnfO{ dgkg]{ s'g} Ps 7fFpsf] j0f{g ug{'xf];\ . #

&= ;k|;ª\u JofVof ug{'xf];\ M #

lrGtf lrGtf x/avt lrGtfÙ lrGt}n] pgnfO{ lrQfsf] af6f] b]vfpg yfNof] .

*= ljj]rgfTds pQ/ lbg'xf];\ M $

s_ …xfd|f] b]z Mxfd|f cltlyÚ lgaGwn] b]zsf] ;f}Gbo{ / xfd|f] cfltYo ;Tsf/nfO{ s;/L k|:t't u/]sf] 5 <

(= tnsf jfSox? sf]i7ssf cfwf/df kl/jt{g ug{'xf];\ M @=%

s_ sdn / sdnf sljtf k9\b} 5g\ . -;fdfGo jt{dfg_

v_ b]jsf]6fn] …zfs'GtnÚ dxfsfJo n]v]sf lyP . -k"0f{ eljiot\_

u_ ;ljgf cfkm\gf] df]6/ rnfpFl5g\ . -ck"0f{ jt{dfg_

3_ ltdL 88]nw'/f hfG5f}F . -;fdfGo eljiot\_

ª_ tkfO{ e|d0f hfb}F x'g'x'GYof] . -ck"0f{ jt{dfg_

!)= tnsf jfSox?sf] ;ª\ult ldnfpg'xf]; M @=%

s_ tL dlxnf v]nf8Lx?n] elnan v]ndf cfk\gf] gfd /fVof] .

v_ xfdL cfk\mgf] b]zsf] pGgltdf ;bf ;dlk{t x'G5f}F .

u_ tF laxfg ;a]/} p7]/ 3'Dg hfg'xf];\ .

3_ d]/f a'afn] dnfO{ pRr lzIffsf] lgldQ ljb]zdf k7fof] .

ª_ ltd|f cleefjsn] ltdLnfO{ z'efzL{jfb b]cf];\ .

!!= /]vfª\lst zAbx?sf] zAbju{ 5'6\ofpg'xf];\ M @=%

s_ clg t j;Gt 5fnfsf] y}nLdf aUbfaUb} Pp6f aGb/ufxdf k'u]5g\ .

v_ To:tL k/d ;'Gb/L o'jtLnfO{ b]v]/ k;n]sf] dgdf kfk p7\of] .

!@= tnsf ;+of]hsnfO{ jfSodf k|of]u ug{'xf];\ M @=%

hxfF — txfF , ha — ta , lsgeg] , To;}n] , clg

!#= cfk"mn] hfg]sf s'g} kfFrcf]6f pvfg n]Vg'xf];\ . @=%

;dfKt

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: English F.M.: 40

Time : 2hrs P.M: 15

Attempt all the questions.

1. Read the poem and do the activities given below: -

Touch!

When I get out Untouched – not quite

I’m going to ask someone I can count the things

to touch me that have touched me

very gently please One: fists

and slowly At the beginning

touch me fierce, mad fists

I want t beating, beating

to learn again till I remember

how life feels screaming

“Don’t touch me,

I’ve not been touched please don’t touch me!”

for seven years

for seven years Two: paws

I’ve been untouched The first four years of paws

out of touch everyday

and I’ve learnt patting paws, searching

to know now arms up, shoes off

the meaning of untouchable legs apart

prodding paws, systematic

heavy, indifferent

probing away

all privacy

I don’t want fist and paws

I want to be touched again

and to touch

I want to feel alive

again

I want to say when I get out

“Here I am

Please touch me!” - Hugh Lewin

A. Find out the similar meaning of the following words: 3

Mild, violent, crying, investigating, solitude, aside

B. Write ‘T’ for true and ‘F’ for false statements :- 3

i) The poem is an appeal for freedom.

ii) He has been there for four years.

iii) He is put in hospital.

iv) He wants to stay there.

v) He wants to be loved and feel like a human being.

C. Write the answer of the following questions: - 4

i) Where was the poem written?

ii) What does the poet want?

iii) Why does he want to get out from that place?

iv) Why he asks people not to touch him in the third verse?

2. Read the passage below and do the activities given below: -

A boy was looking forward to his holidays. “I wish the holidays would come soon!” No more homework, no tests, no getting up early for school” he said to himself. Yet when the holidays came he found that, after three days, he was saying, “ I miss my friends from school. There’s no one to talk at home. I’m tired of watching TV all the time. I’m so bored!”

Have you ever found yourself in this kind of situation? You have lots of time but you don’t know what to do with it. You feel bored. You get restless. You walk from room to room, you look out the window. Then you start walking about the house again soon your mother scolds you for getting in her way. You decide to visit your friends but they are all out. You just don’t know what to do with yourself. This is when you begin wishing for the school term to start again.

Why do people feel bored. It is usually because their minds are not occupied, they have nothing to focus or to take interest in. Some people are never bored, they can always find something to interest them. If they have to wait a long time for a bus, they might amuse themselves by playing a game. For example, they might count the number of people passing by who wear glasses and something red. In the countryside people might look at the sky and notice how the shape of the clouds constantly change or listen to the different kind of sounds made by birds.

A. Find the opposite meaning of the following words: 3

end, always, movable, town, late, backward

B. Write ‘T’ for true and ‘F’ for false statements:

i) The boy didn’t enjoy the holidays very much.

ii) He was bored because he had nothing to do.

iii) He didn’t want to visit his friends.

iv) People feel bored when they don’t use their minds.

v) You can listen to bird songs in a village.

vi) Some people who live in town always count the numbers of people.

C. Write the answer of the following questions: -

i) Why do some people feel bored?

ii) Why are other people never feel bored?

iii) What activities does the writer suggest if you are feeling bored?

iv) Suggest two activities for people who are feeling bored?

3. Your brother is ill. Give him three different kinds of advice. 3

4. Write a letter to your friend about your plan to visit somewhere. 4

5. Fill in the blank spaces with suitable requests and responses: - 6

A: Excuse me. It’s a bit cold in here. ……………………………………………..?

B: ……………………………….. . I can feel the cold wind too.

C: Good morning.

D: Good morning. …………………………. if you can help me. I’m looking for a leather bag.

C: ……………………………….. . There you are.

E: Can I help you?

F: Yes, ……………………. . Put these things in a bag.

E: ……………………………………………………

6. Fill in the blanks with appropriate word from the given boxes: - 7

a) …………………… cow is a gentle animal. (a / an / the)

b) Look! Everybody ………………………… following us. (are / is / has)

c) Don’t cross the road. Taxi ……………………… (is coming / comes / will come)

d) Someone robbed my house. My house ……………………………………………………… (is robbed / was robbed / was being robbed)

e) Let him do what he likes, ……………………….? (shall we / will you / don’t you)

f) The negative of “Ragani did it.” is “Ragani …………………………………………….. it. (didn’t do / doesn’t do / did do)

g) “She gave me a book.” The correct ‘what’ question of the statement is ………………………… (what did she give you? / what did she gave you? / what did she give a book?)

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: Mathematics F.M.: 40

Time : 2hrs P.M: 15

Attempt all the questions.

1. Resolve into factors: a. x3-x2+x-1 b. x2-y2-4x+4

2. Resolve into factors: a. 8x3-27y3 b. (x-1)3+1

3. Resolve into factors: a. x2-x-12 b. 4(2x-1)2+12(2x-1)+9

4. Resolve into factors: a. x4+x2a2+a4 b. x4-6x2-7-8y-y2

5. Simplify: a. b. (64x3y-3

6. Simplify:

7. Solve: a. 3x+1 +3x =108 b. 2x+3. 3x+4

8. If p=ay+z.bx, q= az+x.by, r= ax+y.b2, prove that py-z.qz-x.rx-y = 1

9. Simplify:

10. In a group of 100 students, 68 like football game and 60 like volleyball game. By drawing a venn-diagram, Find

a. How many student like both games?

b. How many students like only football?

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: Mathematics F.M.: 40

Time : 2hrs P.M: 15

Attempt all the questions.

1. Resolve into factors: a. x3-x2+x-1 b. x2-y2-4x+4

2. Resolve into factors: a. 8x3-27y3 b. (x-1)3+1

3. Resolve into factors: a. x2-x-12 b. 4(2x-1)2+12(2x-1)+9

4. Resolve into factors: a. x4+x2a2+a4 b. x4-6x2-7-8y-y2

5. Simplify: a. b. (64x3y-3

6. Simplify:

7. Solve: a. 3x+1 +3x =108 b. 2x+3. 3x+4

8. If p=ay+z.bx, q= az+x.by, r= ax+y.b2, prove that py-z.qz-x.rx-y = 1

9. Simplify:

10. In a group of 100 students, 68 like football game and 60 like volleyball game. By drawing a venn-diagram, Find

a. How many student like both games?

b. How many students like only football?

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: Social F.M.: 40

Time : 2hrs P.M: 15

Group ‘A’ (Very short answer questions) 10

1. Write the definition of development according to UN charter.

2. What do you mean by HDI?

3. Who was the founder of the Human Development Report?

4. Write the definition of sustainable development according to Burndtland Report.

5. What do you mean by infrastructure of development? Write in one sentence.

6. Write the proposed structure of school education by National Curriculum Concept 2063.

7. Write the objective of education in one sentence.

8. What is custom?

9. Who is Margo?

10. Write in one sentence about the Zakat of Islam.

Group ‘B’ (short answer question) 20

11. “Nepal is rich in customs and traditions”. Justify the statement.

12. It is estimated that Nepal has about 83,000 Mw of hydro-electricity potentiality. At present, Nepal has produced less than 600 Mw of hydro- electricity and load-shedding is a phenomenon. What are the reason behind it? Write any four reasons.

13. “Road transport is the best made of transport in the control of Nepal.” Justify the statement.

14. Education is an important infrastructure of development. Prepare a dialogue on it.

15. List the advantages of sustainable development.

Group ‘C’ (long answer question) 10

16. Find out the HDI of Australia whose

PCI= 49, 130 $

Life expectancy = 82years

Literacy rate= 99% (use old method to calculate HDI)

17. What is meant by people’s participation? What are the problems arises in the matter?

Or

18. What are the polices of road construction that Nepal government has adopted during the interim three years plan? Write any five.

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: Social F.M.: 40

Time : 2hrs P.M: 15

Group ‘A’ (Very short answer questions) 10

1. Write the definition of development according to UN charter.

2. What do you mean by HDI?

3. Who was the founder of the Human Development Report?

4. Write the definition of sustainable development according to Burndtland Report.

5. What do you mean by infrastructure of development? Write in one sentence.

6. Write the proposed structure of school education by National Curriculum Concept 2063.

7. Write the objective of education in one sentence.

8. What is custom?

9. Who is Margo?

10. Write in one sentence about the Zakat of Islam.

Group ‘B’ (short answer question) 20

11. “Nepal is rich in customs and traditions”. Justify the statement.

12. It is estimated that Nepal has about 83,000 Mw of hydro-electricity potentiality. At present, Nepal has produced less than 600 Mw of hydro- electricity and load-shedding is a phenomenon. What are the reason behind it? Write any four reasons.

13. “Road transport is the best made of transport in the control of Nepal.” Justify the statement.

14. Education is an important infrastructure of development. Prepare a dialogue on it.

15. List the advantages of sustainable development.

Group ‘C’ (long answer question) 10

16. Find out the HDI of Australia whose

PCI= 49, 130 $

Life expectancy = 82years

Literacy rate= 99% (use old method to calculate HDI)

17. What is meant by people’s participation? What are the problems arises in the matter?

Or

18. What are the polices of road construction that Nepal government has adopted during the interim three years plan? Write any five.

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: Opt. Math F.M.: 40

Time : 2hrs P.M: 15

Attempt all the questions.

1. a. In ABC, AB=5cm, BC=12cm, find cosC, tanC and sinC.

b. From the given triangle, find the trigonometric

ratio of cos and sin.

2. Prove a. sin2+sin2=cos2-cos2

b. sin2+tan2sin2=tan2

3. Prove a. = 1+2tan2sec2 b. = 1-sincos

4. Prove a. sin6+cos6= 1-3sin2cos2

b. If tan= , find sin and cos

5. Prove cos2n2=

b. If cosx= , prove that sec2x-tan2x= 1

6. a. Express all other trigonometric ratio’s in terms of sin.

b. If cos= prove that psinqcos.

7. Prove sin8-cos8=(sin2-cos2)(1-2sin2cos2)

8. Prove (3-4sin2(1-3tan2)= (3-tan2) (4cos2_3)

9. If cos= cos, show that cos-sin= sin

10. If sin= and sin= , show that sincos+cos=

The End

S.R.N.S.B.S.

First Terminal Examination 2072

Class: 9 Sub: Opt. Math F.M.: 40

Time : 2hrs P.M: 15

Attempt all the questions.

1. a. In ABC, AB=5cm, BC=12cm, find cosC, tanC and sinC.

b. From the given triangle, find the trigonometric

ratio of cos and sin.

2. Prove a. sin2+sin2=cos2-cos2

b. sin2+tan2sin2=tan2

3. Prove a. = 1+2tan2sec2 b. = 1-sincos

4. Prove a. sin6+cos6= 1-3sin2cos2

b. If tan= , find sin and cos

5. Prove cos2n2=

b. If cosx= , prove that sec2x-tan2x= 1

6. a. Express all other trigonometric ratio’s in terms of sin.

b. If cos= prove that psinqcos.

7. Prove sin8-cos8=(sin2-cos2)(1-2sin2cos2)

8. Prove (3-4sin2(1-3tan2)= (3-tan2) (4cos2_3)

9. If cos= cos, show that cos-sin= sin

10. If sin= and sin= , show that sincos+cos=

The End